What is the molecular formula of Indole-3-carboxaldehyde?
The molecular formula of Indole-3-carboxaldehyde is C9H7NO.
What is the molecular weight of Indole-3-carboxaldehyde?
The molecular weight of Indole-3-carboxaldehyde is 145.16 g/mol.
What are some synonyms for Indole-3-carboxaldehyde?
Some synonyms for Indole-3-carboxaldehyde include INDOLE-3-CARBOXALDEHYDE, 1H-Indole-3-carbaldehyde, and 3-Formylindole.
What is the IUPAC name of Indole-3-carboxaldehyde?
The IUPAC name of Indole-3-carboxaldehyde is 1H-indole-3-carbaldehyde.
What is the InChIKey of Indole-3-carboxaldehyde?
The InChIKey of Indole-3-carboxaldehyde is OLNJUISKUQQNIM-UHFFFAOYSA-N.
What is the Canonical SMILES of Indole-3-carboxaldehyde?
The Canonical SMILES of Indole-3-carboxaldehyde is C1=CC=C2C(=C1)C(=CN2)C=O.
What is the CAS number for Indole-3-carboxaldehyde?
The CAS number for Indole-3-carboxaldehyde is 487-89-8.
How many hydrogen bond donor counts does Indole-3-carboxaldehyde have?
Indole-3-carboxaldehyde has 1 hydrogen bond donor count.
What is the exact mass of Indole-3-carboxaldehyde?
The exact mass of Indole-3-carboxaldehyde is 145.052763847 g/mol.
What is the topological polar surface area of Indole-3-carboxaldehyde?
The topological polar surface area of Indole-3-carboxaldehyde is 32.9 Å2.