What is the molecular formula of Imidotriphenylphosphorus?
The molecular formula of Imidotriphenylphosphorus is C18H16NP.
What is the molecular weight of Imidotriphenylphosphorus?
The molecular weight of Imidotriphenylphosphorus is 277.3 g/mol.
What is the IUPAC name of Imidotriphenylphosphorus?
The IUPAC name of Imidotriphenylphosphorus is imino(triphenyl)-λ5-phosphane.
What is the InChI of Imidotriphenylphosphorus?
The InChI of Imidotriphenylphosphorus is InChI=1S/C18H16NP/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H.
What is the InChIKey of Imidotriphenylphosphorus?
The InChIKey of Imidotriphenylphosphorus is DHOUOTPZYIKUDF-UHFFFAOYSA-N.
What is the canonical SMILES of Imidotriphenylphosphorus?
The canonical SMILES of Imidotriphenylphosphorus is C1=CC=C(C=C1)P(=N)(C2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of Imidotriphenylphosphorus?
The CAS number of Imidotriphenylphosphorus is 2240-47-3.
What is the EC number of Imidotriphenylphosphorus?
The EC number of Imidotriphenylphosphorus is 218-807-3.
What is the UNII of Imidotriphenylphosphorus?
The UNII of Imidotriphenylphosphorus is F4D68Y2ADX.
Is the compound Imidotriphenylphosphorus canonicalized?
Yes, the compound Imidotriphenylphosphorus is canonicalized.