What is the molecular formula of Fullerene Powder?
The molecular formula of Fullerene Powder is C60.
What is the molecular weight of Fullerene Powder?
The molecular weight of Fullerene Powder is 720.6 g/mol.
When was Fullerene Powder created?
Fullerene Powder was created on September 16, 2004.
What is the role of Fullerene Powder?
Fullerene Powder has a role as a geroprotector.
What is the IUPAC name of Fullerene Powder?
The IUPAC name of Fullerene Powder is (C60-Ih)[5,6]fullerene.
What is the InChIKey of Fullerene Powder?
The InChIKey of Fullerene Powder is XMWRBQBLMFGWIX-UHFFFAOYSA-N.
What is the canonical SMILES of Fullerene Powder?
The canonical SMILES of Fullerene Powder is C12=C3C4=C5C6=C1C7=C8C9=C1C%10=C%11C(=C29)C3=C2C3=C4C4=C5C5=C9C6=C7C6=C7C8=C1C1=C8C%10=C%10C%11=C2C2=C3C3=C4C4=C5C5=C%11C%12=C(C6=C95)C7=C1C1=C%12C5=C%11C4=C3C3=C5C(=C81)C%10=C23.
What is the CAS number of Fullerene Powder?
The CAS number of Fullerene Powder is 99685-96-8.
What is the UNII of Fullerene Powder?
The UNII of Fullerene Powder is NP9U26B839.
What is the European Community (EC) Number of Fullerene Powder?
The European Community (EC) Number of Fullerene Powder is 628-630-7.