What is the molecular formula of Fluorochloridone?
The molecular formula of Fluorochloridone is C12H10Cl2F3NO.
What is the molecular weight of Fluorochloridone?
The molecular weight of Fluorochloridone is 312.11 g/mol.
What is the IUPAC name of Fluorochloridone?
The IUPAC name of Fluorochloridone is 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
What is the InChI of Fluorochloridone?
The InChI of Fluorochloridone is InChI=1S/C12H10Cl2F3NO/c13-5-7-6-18(11(19)10(7)14)9-3-1-2-8(4-9)12(15,16)17/h1-4,7,10H,5-6H2.
What is the InChIKey of Fluorochloridone?
The InChIKey of Fluorochloridone is OQZCSNDVOWYALR-UHFFFAOYSA-N.
What is the canonical SMILES of Fluorochloridone?
The canonical SMILES of Fluorochloridone is C1C(C(C(=O)N1C2=CC=CC(=C2)C(F)(F)F)Cl)CCl.
What is the CAS number of Fluorochloridone?
The CAS number of Fluorochloridone is 61213-25-0.
What is the XLogP3 value of Fluorochloridone?
The XLogP3 value of Fluorochloridone is 3.4.
What is the hydrogen bond donor count of Fluorochloridone?
The hydrogen bond donor count of Fluorochloridone is 0.
What is the hydrogen bond acceptor count of Fluorochloridone?
The hydrogen bond acceptor count of Fluorochloridone is 4.