What is the molecular formula of exo-2-bromonorbornane?
The molecular formula of exo-2-bromonorbornane is C7H11Br.
What is the molecular weight of exo-2-bromonorbornane?
The molecular weight of exo-2-bromonorbornane is 175.07 g/mol.
What is the IUPAC name of exo-2-bromonorbornane?
The IUPAC name of exo-2-bromonorbornane is (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane.
What is the InChI of exo-2-bromonorbornane?
The InChI of exo-2-bromonorbornane is InChI=1S/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1.
What is the InChIKey of exo-2-bromonorbornane?
The InChIKey of exo-2-bromonorbornane is QXYOAWHKJRWNID-VQVTYTSYSA-N.
What is the canonical SMILES representation of exo-2-bromonorbornane?
The canonical SMILES representation of exo-2-bromonorbornane is C1CC2CC1CC2Br.
What is the CAS number of exo-2-bromonorbornane?
The CAS number of exo-2-bromonorbornane is 2534-77-2.
What is the EC number of exo-2-bromonorbornane?
The EC number of exo-2-bromonorbornane is 219-798-9.
Is exo-2-bromonorbornane a canonicalized compound?
Yes, exo-2-bromonorbornane is a canonicalized compound according to PubChem.