What is the molecular formula of Dyclonine hydrochloride?
The molecular formula of Dyclonine hydrochloride is C18H28ClNO2.
What is the molecular weight of Dyclonine hydrochloride?
The molecular weight of Dyclonine hydrochloride is 325.9 g/mol.
What is the IUPAC name of Dyclonine hydrochloride?
The IUPAC name of Dyclonine hydrochloride is 1-(4-butoxyphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride.
What is the InChI key of Dyclonine hydrochloride?
The InChI key of Dyclonine hydrochloride is KNZADIMHVBBPOA-UHFFFAOYSA-N.
What is the canonical SMILES of Dyclonine hydrochloride?
The canonical SMILES of Dyclonine hydrochloride is CCCCOC1=CC=C(C=C1)C(=O)CCN2CCCCC2.Cl.
What is the CAS number of Dyclonine hydrochloride?
The CAS number of Dyclonine hydrochloride is 536-43-6.
What is the UNII of Dyclonine hydrochloride?
The UNII of Dyclonine hydrochloride is ZEC193879Q.
What is the NCI Thesaurus code of Dyclonine hydrochloride?
The NCI Thesaurus code of Dyclonine hydrochloride is C66875.
How does Dyclonine hydrochloride work as a local anesthetic?
Dyclonine hydrochloride reversibly binds to activated sodium channels on the neuronal membrane, decreasing its permeability to sodium ions. This leads to an increased threshold for excitation, stabilizes the membrane, inhibits depolarization, and blocks the propagation of action potential, resulting in a temporary loss of sensation in a localized area.
What is the chemical structure of Dyclonine hydrochloride?
The chemical structure of Dyclonine hydrochloride can be viewed at the following link: [https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=68304&t=l].