What is the molecular formula of 6,7-Dimethoxy-1H-indole?
The molecular formula is C10H11NO2.
What are the synonyms of 6,7-Dimethoxy-1H-indole?
The synonyms are 31165-13-6 and 6,7-Dimethoxyindole.
What is the molecular weight of 6,7-Dimethoxy-1H-indole?
The molecular weight is 177.20 g/mol.
When was 6,7-Dimethoxy-1H-indole created?
It was created on August 9, 2005.
When was the most recent modification made to 6,7-Dimethoxy-1H-indole?
The most recent modification was made on October 21, 2023.
What is the IUPAC name of 6,7-Dimethoxy-1H-indole?
The IUPAC name is 6,7-dimethoxy-1H-indole.
What is the InChI key of 6,7-Dimethoxy-1H-indole?
The InChI key is XYIMIJSUMIEFDG-UHFFFAOYSA-N.
What is the canonical SMILES representation of 6,7-Dimethoxy-1H-indole?
The canonical SMILES representation is COC1=C(C2=C(C=C1)C=CN2)OC.
What is the CAS number of 6,7-Dimethoxy-1H-indole?
The CAS number is 31165-13-6.
What is the topological polar surface area of 6,7-Dimethoxy-1H-indole?
The topological polar surface area is 34.2 Ų.