What is the molecular formula of Di-tert-butyl iminodicarboxylate?
The molecular formula of Di-tert-butyl iminodicarboxylate is C10H19NO4.
What is the molecular weight of Di-tert-butyl iminodicarboxylate?
The molecular weight of Di-tert-butyl iminodicarboxylate is 217.26 g/mol.
What are the synonyms of Di-tert-butyl iminodicarboxylate?
Some synonyms of Di-tert-butyl iminodicarboxylate include Di-tert-butyl Iminodicarboxylate, Di-tert-butyl-iminodicarboxylate, and tert-Butyl iminodicarboxylate.
What is the IUPAC name of Di-tert-butyl iminodicarboxylate?
The IUPAC name of Di-tert-butyl iminodicarboxylate is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
What is the InChIKey of Di-tert-butyl iminodicarboxylate?
The InChIKey of Di-tert-butyl iminodicarboxylate is XCAQIUOFDMREBA-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Di-tert-butyl iminodicarboxylate?
The Canonical SMILES representation of Di-tert-butyl iminodicarboxylate is CC(C)(C)OC(=O)NC(=O)OC(C)(C)C.
What is the CAS number of Di-tert-butyl iminodicarboxylate?
The CAS number of Di-tert-butyl iminodicarboxylate is 51779-32-9.
How many hydrogen bond donor counts are there in Di-tert-butyl iminodicarboxylate?
There is 1 hydrogen bond donor count in Di-tert-butyl iminodicarboxylate.
What is the exact mass of Di-tert-butyl iminodicarboxylate?
The exact mass of Di-tert-butyl iminodicarboxylate is 217.13140809 g/mol.
How many rotatable bond counts are there in Di-tert-butyl iminodicarboxylate?
There are 4 rotatable bond counts in Di-tert-butyl iminodicarboxylate.
※ Please kindly note that our products are for research use only.