What is the PubChem CID of the compound BSBF?
The PubChem CID of the compound BSBF is 57373041.
What is the molecular formula of BSBF?
The molecular formula of BSBF is C50H30.
What is the molecular weight of BSBF?
The molecular weight of BSBF is 630.8 g/mol.
When was BSBF created and last modified according to PubChem?
BSBF was created on July 13, 2012, and last modified on December 30, 2023.
What is the IUPAC name of BSBF?
The IUPAC name of BSBF is 2-(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene].
What is the InChI of BSBF?
The InChI of BSBF is InChI=1S/C50H30/c1-7-19-41-33(13-1)34-14-2-8-20-42(34)49(41)45-23-11-5-17-37(45)39-27-25-31(29-47(39)49)32-26-28-40-38-18-6-12-24-46(38)50(48(40)30-32)43-21-9-3-15-35(43)36-16-4-10-22-44(36)50/h1-30H.
What is the InChIKey of BSBF?
The InChIKey of BSBF is RASFLGVDOLMZBD-UHFFFAOYSA-N.
What is the canonical SMILES of BSBF?
The canonical SMILES of BSBF is C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)C7=CC8=C(C=C7)C9=CC=CC=C9C81C2=CC=CC=C2C2=CC=CC=C12.
What is the XLogP3-AA value of BSBF?
The XLogP3-AA value of BSBF is 12.5.
How many hydrogen bond donor and acceptor counts does BSBF have?
BSBF has 0 hydrogen bond donor counts and 0 hydrogen bond acceptor counts.