What is the molecular formula of Boc-Val-OH?
The molecular formula of Boc-Val-OH is C10H19NO4.
What is the molecular weight of Boc-Val-OH?
The molecular weight of Boc-Val-OH is 217.26 g/mol.
What is the IUPAC name of Boc-Val-OH?
The IUPAC name of Boc-Val-OH is (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
What is the InChI of Boc-Val-OH?
The InChI of Boc-Val-OH is InChI=1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1.
What is the InChIKey of Boc-Val-OH?
The InChIKey of Boc-Val-OH is SZXBQTSZISFIAO-ZETCQYMHSA-N.
What is the canonical SMILES of Boc-Val-OH?
The canonical SMILES of Boc-Val-OH is CC(C)C(C(=O)O)NC(=O)OC(C)(C)C.
What is the CAS number of Boc-Val-OH?
The CAS number of Boc-Val-OH is 13734-41-3.
What is the XLogP3 value of Boc-Val-OH?
The XLogP3 value of Boc-Val-OH is 1.5.
How many hydrogen bond donor counts does Boc-Val-OH have?
Boc-Val-OH has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Boc-Val-OH have?
Boc-Val-OH has 4 hydrogen bond acceptor counts.