In drug synthesis, 2-Boc-aminomethyl-phenylboronic acid pinacol ester can prepare anti-HBV drugs.
What is the molecular formula of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The molecular formula is C18H28BNO4.
What are the synonyms of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The synonyms include tert-Butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzylcarbamate, 2-[(Boc-amino)methyl]phenylboronic Acid Pinacol Ester, and 2-BOC-AMINOMETHYL-PHENYLBORONIC ACID PINACOL ESTER.
What is the molecular weight of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The molecular weight is 333.2 g/mol.
When was 2-Boc-aminomethyl-phenylboronic acid pinacol ester created?
It was created on March 8, 2012.
When was 2-Boc-aminomethyl-phenylboronic acid pinacol ester last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The IUPAC name is tert-butyl N-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate.
What is the InChI of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The InChI is InChI=1S/C18H28BNO4/c1-16(2,3)22-15(21)20-12-13-10-8-9-11-14(13)19-23-17(4,5)18(6,7)24-19/h8-11H,12H2,1-7H3,(H,20,21).
What is the InChIKey of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The InChIKey is SUTPCHZGPJIFEN-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CNC(=O)OC(C)(C)C.
What is the CAS number of 2-Boc-aminomethyl-phenylboronic acid pinacol ester?
The CAS number is 905300-76-7.
※ Please kindly note that our products are for research use only.