What is the molecular formula of Boc-Ala-OH?
The molecular formula of Boc-Ala-OH is C8H15NO4.
What are the synonyms for Boc-Ala-OH?
The synonyms for Boc-Ala-OH are 15761-38-3, Boc-l-alanine, N-(tert-Butoxycarbonyl)-L-alanine, and N-Boc-L-alanine.
What is the molecular weight of Boc-Ala-OH?
The molecular weight of Boc-Ala-OH is 189.21 g/mol.
When was Boc-Ala-OH created?
Boc-Ala-OH was created on August 8, 2005.
What is the IUPAC name of Boc-Ala-OH?
The IUPAC name of Boc-Ala-OH is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
What is the InChI of Boc-Ala-OH?
The InChI of Boc-Ala-OH is InChI=1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1.
What is the InChIKey of Boc-Ala-OH?
The InChIKey of Boc-Ala-OH is QVHJQCGUWFKTSE-YFKPBYRVSA-N.
What is the canonical SMILES of Boc-Ala-OH?
The canonical SMILES of Boc-Ala-OH is CC(C(=O)O)NC(=O)OC(C)(C)C.
What is the CAS number of Boc-Ala-OH?
The CAS number of Boc-Ala-OH is 15761-38-3.
What is the XLogP3-AA value of Boc-Ala-OH?
The XLogP3-AA value of Boc-Ala-OH is 0.9.