What is the molecular formula of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The molecular formula is C10H4O2S2.
What are some synonyms of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
Some synonyms include benzo[1,2-b:4,5-b']dithiophene-4,8-dione, thieno[2,3-f][1]benzothiole-4,8-dione, NSC149690, and thieno[2,3-f]benzothiophene-4,8-dione.
What is the molecular weight of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The molecular weight is 220.3 g/mol.
What is the IUPAC name of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The IUPAC name is thieno[2,3-f][1]benzothiole-4,8-dione.
What is the InChI of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The InChI is InChI=1S/C10H4O2S2/c11-7-5-1-3-13-9(5)8(12)6-2-4-14-10(6)7/h1-4H.
What is the InChIKey of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The InChIKey is SIUXRPJYVQQBAF-UHFFFAOYSA-N.
What is the canonical SMILES of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The canonical SMILES is C1=CSC2=C1C(=O)C3=C(C2=O)C=CS3.
What is the CAS number of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The CAS number is 32281-36-0.
What is the UNII of benzo[1,2-b:4,5-b]dithiophene-4,8-dione?
The UNII is G1C271HP09.
Is benzo[1,2-b:4,5-b]dithiophene-4,8-dione a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.