What is the molecular formula of Benzene-1,3,5-tricarboxaldehyde?
The molecular formula of Benzene-1,3,5-tricarboxaldehyde is C9H6O3.
What are the synonyms of Benzene-1,3,5-tricarboxaldehyde?
The synonyms of Benzene-1,3,5-tricarboxaldehyde are Benzene-1,3,5-tricarbaldehyde, 3163-76-6, 1,3,5-Benzenetricarboxaldehyde, and 1,3,5-TRIFORMYLBENZENE.
What is the molecular weight of Benzene-1,3,5-tricarboxaldehyde?
The molecular weight of Benzene-1,3,5-tricarboxaldehyde is 162.14 g/mol.
What is the IUPAC name of Benzene-1,3,5-tricarboxaldehyde?
The IUPAC name of Benzene-1,3,5-tricarboxaldehyde is benzene-1,3,5-tricarbaldehyde.
What is the InChI of Benzene-1,3,5-tricarboxaldehyde?
The InChI of Benzene-1,3,5-tricarboxaldehyde is InChI=1S/C9H6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-6H.
What is the InChIKey of Benzene-1,3,5-tricarboxaldehyde?
The InChIKey of Benzene-1,3,5-tricarboxaldehyde is AEKQNAANFVOBCU-UHFFFAOYSA-N.
What is the canonical SMILES of Benzene-1,3,5-tricarboxaldehyde?
The canonical SMILES of Benzene-1,3,5-tricarboxaldehyde is C1=C(C=C(C=C1C=O)C=O)C=O.
What is the CAS number of Benzene-1,3,5-tricarboxaldehyde?
The CAS number of Benzene-1,3,5-tricarboxaldehyde is 3163-76-6.
What is the European Community (EC) Number of Benzene-1,3,5-tricarboxaldehyde?
The European Community (EC) Number of Benzene-1,3,5-tricarboxaldehyde is 694-839-5.
What is the topological polar surface area of Benzene-1,3,5-tricarboxaldehyde?
The topological polar surface area of Benzene-1,3,5-tricarboxaldehyde is 51.2Ų.