What is the PubChem CID of Artepillin C?
The PubChem CID of Artepillin C is 5472440.
What is the molecular formula of Artepillin C?
The molecular formula of Artepillin C is C19H24O3.
What are some synonyms of Artepillin C?
Some synonyms of Artepillin C are Artepillin C, artepillin, and (E)-3-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]prop-2-enoic acid.
What is the molecular weight of Artepillin C?
The molecular weight of Artepillin C is 300.4 g/mol.
What is the IUPAC name of Artepillin C?
The IUPAC name of Artepillin C is (E)-3-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]prop-2-enoic acid.
What is the InChI of Artepillin C?
The InChI of Artepillin C is InChI=1S/C19H24O3/c1-13(2)5-8-16-11-15(7-10-18(20)21)12-17(19(16)22)9-6-14(3)4/h5-7,10-12,22H,8-9H2,1-4H3,(H,20,21)/b10-7+.
What is the InChIKey of Artepillin C?
The InChIKey of Artepillin C is KABCFARPAMSXCC-JXMROGBWSA-N.
What is the canonical SMILES of Artepillin C?
The canonical SMILES of Artepillin C is CC(=CCC1=CC(=CC(=C1O)CC=C(C)C)C=CC(=O)O)C.
What is the CAS number of Artepillin C?
The CAS number of Artepillin C is 72944-19-5.