What is the molecular formula of Tris(2,4-di-tert-butylphenyl) Phosphite?
The molecular formula is C42H63O3P.
What is the molecular weight of Tris(2,4-di-tert-butylphenyl) Phosphite?
The molecular weight is 646.9 g/mol.
What is the IUPAC name of Tris(2,4-di-tert-butylphenyl) Phosphite?
The IUPAC name is tris(2,4-ditert-butylphenyl) phosphite.
What is the InChI of Tris(2,4-di-tert-butylphenyl) Phosphite?
The InChI is InChI=1S/C42H63O3P/c1-37(2,3)28-19-22-34(31(25-28)40(10,11)12)43-46(44-35-23-20-29(38(4,5)6)26-32(35)41(13,14)15)45-36-24-21-30(39(7,8)9)27-33(36)42(16,17)18/h19-27H,1-18H3.
What is the InChIKey of Tris(2,4-di-tert-butylphenyl) Phosphite?
The InChIKey is JKIJEFPNVSHHEI-UHFFFAOYSA-N.
What is the Canonical SMILES of Tris(2,4-di-tert-butylphenyl) Phosphite?
The Canonical SMILES is CC(C)(C)C1=CC(=C(C=C1)OP(OC2=C(C=C(C=C2)C(C)(C)C)C(C)(C)C)OC3=C(C=C(C=C3)C(C)(C)C)C(C)(C)C)C(C)(C)C.
What is the CAS number of Tris(2,4-di-tert-butylphenyl) Phosphite?
The CAS number is 31570-04-4.
What is the molecular weight of Tris(2,4-di-tert-butylphenyl) Phosphite according to PubChem?
The molecular weight is 646.9 g/mol.
How many hydrogen bond donor counts does Tris(2,4-di-tert-butylphenyl) Phosphite have?
It has 0 hydrogen bond donor counts.
How many rotatable bond counts does Tris(2,4-di-tert-butylphenyl) Phosphite have?
It has 12 rotatable bond counts.