What is the molecular formula of Cannabicyclol?
The molecular formula of Cannabicyclol is C21H30O2.
When was Cannabicyclol first created?
Cannabicyclol was first created on March 27, 2005.
What is the molecular weight of Cannabicyclol?
The molecular weight of Cannabicyclol is 314.5 g/mol.
How many synonyms are listed for Cannabicyclol in the reference?
Four synonyms are listed for Cannabicyclol in the reference.
What is the Canonical SMILES representation for Cannabicyclol?
The Canonical SMILES representation for Cannabicyclol is CCCCCC1=CC(=C2C3C4C(C3(C)C)CCC4(OC2=C1)C)O.
What is the InChIKey for Cannabicyclol?
The InChIKey for Cannabicyclol is IGHTZQUIFGUJTG-UHFFFAOYSA-N.
What is the XLogP3-AA property value for Cannabicyclol?
The XLogP3-AA property value for Cannabicyclol is 6.
How many hydrogen bond acceptors does Cannabicyclol have?
Cannabicyclol has two hydrogen bond acceptors.
What is the exact mass of Cannabicyclol?
The exact mass of Cannabicyclol is 314.224580195 g/mol.
Is Cannabicyclol a canonicalized compound?
Yes, Cannabicyclol is a canonicalized compound according to PubChem.