What is the molecular formula of 9,9-Dimethylxanthene?
The molecular formula of 9,9-Dimethylxanthene is C15H14O.
What is the molecular weight of 9,9-Dimethylxanthene?
The molecular weight of 9,9-Dimethylxanthene is 210.27 g/mol.
What is the IUPAC name of 9,9-Dimethylxanthene?
The IUPAC name of 9,9-Dimethylxanthene is 9,9-dimethylxanthene.
What is the InChI of 9,9-Dimethylxanthene?
The InChI of 9,9-Dimethylxanthene is InChI=1S/C15H14O/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10H,1-2H3.
What is the InChIKey of 9,9-Dimethylxanthene?
The InChIKey of 9,9-Dimethylxanthene is MTVNAPYHLASOSX-UHFFFAOYSA-N.
What is the canonical SMILES of 9,9-Dimethylxanthene?
The canonical SMILES of 9,9-Dimethylxanthene is CC1(C2=CC=CC=C2OC3=CC=CC=C31)C.
What is the CAS number of 9,9-Dimethylxanthene?
The CAS number of 9,9-Dimethylxanthene is 19814-75-6.
How many hydrogen bond donor counts does 9,9-Dimethylxanthene have?
9,9-Dimethylxanthene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 9,9-Dimethylxanthene have?
9,9-Dimethylxanthene has 1 hydrogen bond acceptor count.