What is the molecular formula of 7-Aminoheptanoic acid?
The molecular formula of 7-Aminoheptanoic acid is C7H15NO2.
What are the synonyms of 7-Aminoheptanoic acid?
The synonyms of 7-Aminoheptanoic acid include 7-Aminoenanthic acid, HEPTANOIC ACID, 7-AMINO-, omega-Aminoenantic acid, and more.
What is the IUPAC name of 7-Aminoheptanoic acid?
The IUPAC name of 7-Aminoheptanoic acid is 7-aminoheptanoic acid.
What is the InChI of 7-Aminoheptanoic acid?
The InChI of 7-Aminoheptanoic acid is InChI=1S/C7H15NO2/c8-6-4-2-1-3-5-7(9)10/h1-6,8H2,(H,9,10).
What is the InChIKey of 7-Aminoheptanoic acid?
The InChIKey of 7-Aminoheptanoic acid is XDOLZJYETYVRKV-UHFFFAOYSA-N.
What is the CAS number of 7-Aminoheptanoic acid?
The CAS number of 7-Aminoheptanoic acid is 929-17-9.
What is the molecular weight of 7-Aminoheptanoic acid?
The molecular weight of 7-Aminoheptanoic acid is 145.20 g/mol.
How many hydrogen bond donor counts are there in 7-Aminoheptanoic acid?
There are 2 hydrogen bond donor counts in 7-Aminoheptanoic acid.
How many hydrogen bond acceptor counts are there in 7-Aminoheptanoic acid?
There are 3 hydrogen bond acceptor counts in 7-Aminoheptanoic acid.
How many rotatable bond counts are there in 7-Aminoheptanoic acid?
There are 6 rotatable bond counts in 7-Aminoheptanoic acid.