What is the molecular formula of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The molecular formula of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is C12H13NO3.
What are the synonyms of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The synonyms of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester are Ethyl 6-methoxy-1H-indole-2-carboxylate and 1H-Indole-2-carboxylic acid, 6-methoxy-, ethyl ester.
What is the molecular weight of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The molecular weight of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is 219.24 g/mol.
When was 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester created?
6-Methoxy-1H-indole-2-carboxylic acid ethyl ester was created on March 27, 2005.
What is the IUPAC name of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The IUPAC name of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is ethyl 6-methoxy-1H-indole-2-carboxylate.
What is the InChI of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The InChI of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is InChI=1S/C12H13NO3/c1-3-16-12(14)11-6-8-4-5-9(15-2)7-10(8)13-11/h4-7,13H,3H2,1-2H3.
What is the InChIKey of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The InChIKey of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is HYFAOIAKHGVBMX-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The Canonical SMILES of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is CCOC(=O)C1=CC2=C(N1)C=C(C=C2)OC.
What is the CAS number of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester?
The CAS number of 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester is 15050-04-1.
※ Please kindly note that our products are for research use only.