What is the molecular formula of 5-Methylindolin-2-one?
The molecular formula of 5-Methylindolin-2-one is C9H9NO.
What is the molecular weight of 5-Methylindolin-2-one?
The molecular weight of 5-Methylindolin-2-one is 147.17 g/mol.
When was 5-Methylindolin-2-one created?
5-Methylindolin-2-one was created on January 25, 2006.
When was 5-Methylindolin-2-one last modified?
5-Methylindolin-2-one was last modified on December 30, 2023.
What is the IUPAC name of 5-Methylindolin-2-one?
The IUPAC name of 5-Methylindolin-2-one is 5-methyl-1,3-dihydroindol-2-one.
What is the InChI of 5-Methylindolin-2-one?
The InChI of 5-Methylindolin-2-one is InChI=1S/C9H9NO/c1-6-2-3-8-7(4-6)5-9(11)10-8/h2-4H,5H2,1H3,(H,10,11).
What is the InChIKey of 5-Methylindolin-2-one?
The InChIKey of 5-Methylindolin-2-one is HXQDSHSATAEREW-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Methylindolin-2-one?
The canonical SMILES of 5-Methylindolin-2-one is CC1=CC2=C(C=C1)NC(=O)C2.
What is the CAS number of 5-Methylindolin-2-one?
The CAS number of 5-Methylindolin-2-one is 3484-35-3.