The synonyms of the compound are 871329-53-2, 5-(METHOXYCARBONYL)PYRIDINE-3-BORONIC ACID, (5-(Methoxycarbonyl)pyridin-3-yl)boronic acid, 5-(methoxycarbonyl)pyridin-3-ylboronic acid, and METHYL 5-BORONONICOTINATE.
What is the molecular weight of the compound?
The molecular weight is 180.96 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is (5-methoxycarbonylpyridin-3-yl)boronic acid.
What is the InChI of the compound?
The InChI is InChI=1S/C7H8BNO4/c1-13-7(10)5-2-6(8(11)12)4-9-3-5/h2-4,11-12H,1H3.
What is the InChIKey of the compound?
The InChIKey is PGTWAVVFCNTGCS-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is B(C1=CC(=CN=C1)C(=O)OC)(O)O.
What is the CAS number of the compound?
The CAS number is 871329-53-2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count is 2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.