What is the PubChem CID of 5-Bromophthalide?
The PubChem CID of 5-Bromophthalide is 603144.
What is the molecular formula of 5-Bromophthalide?
The molecular formula of 5-Bromophthalide is C8H5BrO2.
What is the molecular weight of 5-Bromophthalide?
The molecular weight of 5-Bromophthalide is 213.03 g/mol.
What is the IUPAC name of 5-Bromophthalide?
The IUPAC name of 5-Bromophthalide is 5-bromo-3H-2-benzofuran-1-one.
What is the InChI of 5-Bromophthalide?
The InChI of 5-Bromophthalide is InChI=1S/C8H5BrO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3H,4H2.
What is the InChIKey of 5-Bromophthalide?
The InChIKey of 5-Bromophthalide is IUSPXLCLQIZFHL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromophthalide?
The canonical SMILES of 5-Bromophthalide is C1C2=C(C=CC(=C2)Br)C(=O)O1.
What is the CAS number of 5-Bromophthalide?
The CAS number of 5-Bromophthalide is 64169-34-2.
What is the European Community (EC) number of 5-Bromophthalide?
The European Community (EC) number of 5-Bromophthalide is 613-485-4.
Is 5-Bromophthalide a canonicalized compound?
Yes, 5-Bromophthalide is a canonicalized compound according to PubChem.