What is the molecular formula of 5-bromo-2-nitroaniline?
The molecular formula of 5-bromo-2-nitroaniline is C6H5BrN2O2.
What is the molecular weight of 5-bromo-2-nitroaniline?
The molecular weight of 5-bromo-2-nitroaniline is 217.02 g/mol.
What is the IUPAC name of 5-bromo-2-nitroaniline?
The IUPAC name of 5-bromo-2-nitroaniline is 5-bromo-2-nitroaniline.
What is the InChI of 5-bromo-2-nitroaniline?
The InChI of 5-bromo-2-nitroaniline is InChI=1S/C6H5BrN2O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H,8H2.
What is the InChIKey of 5-bromo-2-nitroaniline?
The InChIKey of 5-bromo-2-nitroaniline is RMIFLIVHJLREFJ-UHFFFAOYSA-N.
What is the canonical SMILES of 5-bromo-2-nitroaniline?
The canonical SMILES of 5-bromo-2-nitroaniline is C1=CC(=C(C=C1Br)N)[N+](=O)[O-].
What is the CAS number of 5-bromo-2-nitroaniline?
The CAS number of 5-bromo-2-nitroaniline is 5228-61-5.
What is the EC number of 5-bromo-2-nitroaniline?
The EC number of 5-bromo-2-nitroaniline is 837-975-4.
What is the molecular weight of 5-bromo-2-nitroaniline according to PubChem?
The molecular weight of 5-bromo-2-nitroaniline according to PubChem is 217.02 g/mol.
Is 5-bromo-2-nitroaniline a canonicalized compound?
Yes, 5-bromo-2-nitroaniline is a canonicalized compound according to PubChem.