What is the molecular formula of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The molecular formula is C8H12Cl2Si.
What are the synonyms of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The synonyms are 18245-94-8, 5-(Bicycloheptenyl)methyldichlorosilane, Bicyclo(2.2.1)hept-2-ene, 5-(dichloromethylsilyl)-, and Bicyclo[2.2.1]hept-5-en-2-yldichloro(methyl)silane.
What is the molecular weight of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The molecular weight is 207.17 g/mol.
When was (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane created?
It was created on August 8, 2005.
When was (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane last modified?
It was last modified on November 25, 2023.
What is the IUPAC name of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl-dichloro-methylsilane.
What is the InChI of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The InChI is InChI=1S/C8H12Cl2Si/c1-11(9,10)8-5-6-2-3-7(8)4-6/h2-3,6-8H,4-5H2,1H3.
What is the InChIKey of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The InChIKey is LYTATDHKONFXEH-UHFFFAOYSA-N.
What is the Canonical SMILES of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The Canonical SMILES is C[Si](C1CC2CC1C=C2)(Cl)Cl.
What is the CAS number of (5-Bicyclo[2.2.1]hept-2-enyl)methyldichlorosilane?
The CAS number is 18245-94-8.
※ Please kindly note that our products are for research use only.