What is the molecular formula of 5,6-Difluoroindole?
The molecular formula of 5,6-Difluoroindole is C8H5F2N.
What is the molecular weight of 5,6-Difluoroindole?
The molecular weight of 5,6-Difluoroindole is 153.13 g/mol.
What is the IUPAC name of 5,6-Difluoroindole?
The IUPAC name of 5,6-Difluoroindole is 5,6-difluoro-1H-indole.
What is the InChI of 5,6-Difluoroindole?
The InChI of 5,6-Difluoroindole is InChI=1S/C8H5F2N/c9-6-3-5-1-2-11-8(5)4-7(6)10/h1-4,11H.
What is the InChIKey of 5,6-Difluoroindole?
The InChIKey of 5,6-Difluoroindole is YCVSNMPGFSFANR-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 5,6-Difluoroindole have?
5,6-Difluoroindole has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5,6-Difluoroindole have?
5,6-Difluoroindole has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 5,6-Difluoroindole?
The topological polar surface area of 5,6-Difluoroindole is 15.8 Ų.
Is 5,6-Difluoroindole a canonicalized compound?
Yes, 5,6-Difluoroindole is a canonicalized compound.
What is the exact mass of 5,6-Difluoroindole?
The exact mass of 5,6-Difluoroindole is 153.03900549 g/mol.