What is the PubChem CID of 4-Methoxycinnamic acid?
The PubChem CID of 4-Methoxycinnamic acid is 699414.
What is the molecular formula of 4-Methoxycinnamic acid?
The molecular formula of 4-Methoxycinnamic acid is C10H10O3.
What is the molecular weight of 4-Methoxycinnamic acid?
The molecular weight of 4-Methoxycinnamic acid is 178.18 g/mol.
What is the IUPAC name of 4-Methoxycinnamic acid?
The IUPAC name of 4-Methoxycinnamic acid is (E)-3-(4-methoxyphenyl)prop-2-enoic acid.
What is the InChI of 4-Methoxycinnamic acid?
The InChI of 4-Methoxycinnamic acid is InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+.
What is the InChIKey of 4-Methoxycinnamic acid?
The InChIKey of 4-Methoxycinnamic acid is AFDXODALSZRGIH-QPJJXVBHSA-N.
What is the canonical SMILES of 4-Methoxycinnamic acid?
The canonical SMILES of 4-Methoxycinnamic acid is COC1=CC=C(C=C1)C=CC(=O)O.
What is another name for 4-Methoxycinnamic acid?
Another name for 4-Methoxycinnamic acid is P-METHOXYCINNAMIC ACID.
What is the CAS number of 4-Methoxycinnamic acid?
The CAS number of 4-Methoxycinnamic acid is 943-89-5.
What is the ChEMBL ID of 4-Methoxycinnamic acid?
The ChEMBL ID of 4-Methoxycinnamic acid is CHEMBL95770.