What is the molecular formula of 4-Hydroxy-bz-gly-oh?
The molecular formula of 4-Hydroxy-bz-gly-oh is C9H9NO4.
What is the molecular weight of 4-Hydroxy-bz-gly-oh?
The molecular weight of 4-Hydroxy-bz-gly-oh is 195.17 g/mol.
What are the synonyms for 4-Hydroxy-bz-gly-oh?
The synonyms for 4-Hydroxy-bz-gly-oh include 4-Hydroxyhippuric acid, p-Hydroxyhippuric acid, and 2-[(4-hydroxyphenyl)formamido]acetic acid.
Is 4-Hydroxy-bz-gly-oh a natural product?
Yes, 4-Hydroxy-bz-gly-oh is a natural product found in Ginkgo biloba and Drosophila melanogaster.
What is the IUPAC name of 4-Hydroxy-bz-gly-oh?
The IUPAC name of 4-Hydroxy-bz-gly-oh is 2-[(4-hydroxybenzoyl)amino]acetic acid.
What is the InChI of 4-Hydroxy-bz-gly-oh?
The InChI of 4-Hydroxy-bz-gly-oh is InChI=1S/C9H9NO4/c11-7-3-1-6(2-4-7)9(14)10-5-8(12)13/h1-4,11H,5H2,(H,10,14)(H,12,13).
What is the InChIKey of 4-Hydroxy-bz-gly-oh?
The InChIKey of 4-Hydroxy-bz-gly-oh is ZMHLUFWWWPBTIU-UHFFFAOYSA-N.
What is the CAS number of 4-Hydroxy-bz-gly-oh?
The CAS number of 4-Hydroxy-bz-gly-oh is 2482-25-9.
What is the hydrogen bond donor count of 4-Hydroxy-bz-gly-oh?
The hydrogen bond donor count of 4-Hydroxy-bz-gly-oh is 3.
What is the hydrogen bond acceptor count of 4-Hydroxy-bz-gly-oh?
The hydrogen bond acceptor count of 4-Hydroxy-bz-gly-oh is 4.