What is the molecular formula of 4-Fluorobenzaldehyde?
The molecular formula of 4-Fluorobenzaldehyde is C7H5FO.
What is the molecular weight of 4-Fluorobenzaldehyde?
The molecular weight of 4-Fluorobenzaldehyde is 124.11 g/mol.
What is the IUPAC name of 4-Fluorobenzaldehyde?
The IUPAC name of 4-Fluorobenzaldehyde is 4-fluorobenzaldehyde.
What is the InChI of 4-Fluorobenzaldehyde?
The InChI of 4-Fluorobenzaldehyde is InChI=1S/C7H5FO/c8-7-3-1-6(5-9)2-4-7/h1-5H.
What is the InChIKey of 4-Fluorobenzaldehyde?
The InChIKey of 4-Fluorobenzaldehyde is UOQXIWFBQSVDPP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluorobenzaldehyde?
The canonical SMILES of 4-Fluorobenzaldehyde is C1=CC(=CC=C1C=O)F.
What is the CAS number of 4-Fluorobenzaldehyde?
The CAS number of 4-Fluorobenzaldehyde is 459-57-4.
What is the XLogP3 value of 4-Fluorobenzaldehyde?
The XLogP3 value of 4-Fluorobenzaldehyde is 1.6.
How many hydrogen bond donor counts are there in 4-Fluorobenzaldehyde?
There are no hydrogen bond donor counts in 4-Fluorobenzaldehyde.
How many hydrogen bond acceptor counts are there in 4-Fluorobenzaldehyde?
There are two hydrogen bond acceptor counts in 4-Fluorobenzaldehyde.