What is the molecular formula of 4-(Bromomethyl)-biphenyl?
The molecular formula is C13H11Br.
What is the molecular weight of 4-(Bromomethyl)-biphenyl?
The molecular weight is 247.13 g/mol.
What is the IUPAC name of 4-(Bromomethyl)-biphenyl?
The IUPAC name is 1-(bromomethyl)-4-phenylbenzene.
What is the InChI of 4-(Bromomethyl)-biphenyl?
The InChI is InChI=1S/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2.
What is the InChIKey of 4-(Bromomethyl)-biphenyl?
The InChIKey is HZQLUIZFUXNFHK-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-(Bromomethyl)-biphenyl?
The Canonical SMILES is C1=CC=C(C=C1)C2=CC=C(C=C2)CBr.
What is the CAS number of 4-(Bromomethyl)-biphenyl?
The CAS number is 2567-29-5.
What is the European Community (EC) number of 4-(Bromomethyl)-biphenyl?
The European Community (EC) number is 663-894-7.
What is the DSSTox Substance ID of 4-(Bromomethyl)-biphenyl?
The DSSTox Substance ID is DTXSID40292866.
Is 4-(Bromomethyl)-biphenyl considered a canonicalized compound?
Yes, 4-(Bromomethyl)-biphenyl is a canonicalized compound.