What is the molecular formula of 4-Bromo-2-methoxyaniline?
The molecular formula of 4-Bromo-2-methoxyaniline is C7H8BrNO.
What is the molecular weight of 4-Bromo-2-methoxyaniline?
The molecular weight of 4-Bromo-2-methoxyaniline is 202.05 g/mol.
What is the IUPAC name of 4-Bromo-2-methoxyaniline?
The IUPAC name of 4-Bromo-2-methoxyaniline is 4-bromo-2-methoxyaniline.
What is the InChI of 4-Bromo-2-methoxyaniline?
The InChI of 4-Bromo-2-methoxyaniline is InChI=1S/C7H8BrNO/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,9H2,1H3.
What is the InChIKey of 4-Bromo-2-methoxyaniline?
The InChIKey of 4-Bromo-2-methoxyaniline is WRFYIYOXJWKONR-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-methoxyaniline?
The canonical SMILES of 4-Bromo-2-methoxyaniline is COC1=C(C=CC(=C1)Br)N.
What is the CAS number of 4-Bromo-2-methoxyaniline?
The CAS number of 4-Bromo-2-methoxyaniline is 59557-91-4.
What is the European Community (EC) number of 4-Bromo-2-methoxyaniline?
The European Community (EC) number of 4-Bromo-2-methoxyaniline is 641-300-7.
What is the ChEMBL ID of 4-Bromo-2-methoxyaniline?
The ChEMBL ID of 4-Bromo-2-methoxyaniline is CHEMBL4991363.
Is 4-Bromo-2-methoxyaniline a canonicalized compound?
Yes, 4-Bromo-2-methoxyaniline is a canonicalized compound according to PubChem.