What is the molecular formula of 4-Benzyloxy-2-hydroxybenzaldehyde?
The molecular formula is C14H12O3.
What are the synonyms for 4-Benzyloxy-2-hydroxybenzaldehyde?
The synonyms are 4-(Benzyloxy)-2-hydroxybenzaldehyde, 52085-14-0, 2-hydroxy-4-phenylmethoxybenzaldehyde, and Benzaldehyde, 2-hydroxy-4-(phenylmethoxy)-.
What is the molecular weight of 4-Benzyloxy-2-hydroxybenzaldehyde?
The molecular weight is 228.24 g/mol.
What is the IUPAC name of 4-Benzyloxy-2-hydroxybenzaldehyde?
The IUPAC name is 2-hydroxy-4-phenylmethoxybenzaldehyde.
What is the InChI of 4-Benzyloxy-2-hydroxybenzaldehyde?
The InChI is InChI=1S/C14H12O3/c15-9-12-6-7-13(8-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2.
What is the InChIKey of 4-Benzyloxy-2-hydroxybenzaldehyde?
The InChIKey is AMLKEDBYDOCGEG-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Benzyloxy-2-hydroxybenzaldehyde?
The canonical SMILES is C1=CC=C(C=C1)COC2=CC(=C(C=C2)C=O)O.
What is the CAS number of 4-Benzyloxy-2-hydroxybenzaldehyde?
The CAS number is 52085-14-0.
What is the European Community (EC) number of 4-Benzyloxy-2-hydroxybenzaldehyde?
The EC number is 676-541-7.
What is the molecular weight of 4-Benzyloxy-2-hydroxybenzaldehyde according to PubChem?
The molecular weight is 228.24 g/mol according to PubChem.
※ Please kindly note that our products are for research use only.