Some synonyms for the compound are "13580-38-6," "3-prop-2-ynoxypropane-1,2-diol," "3-(prop-2-yn-1-yloxy)propane-1,2-diol," "EINECS 237-012-2," and "3-(2-Propynyloxy)propane-1,2-diol."
What is the molecular weight of the compound?
The molecular weight is 130.14 g/mol.
When was the compound created?
The compound was created on March 26, 2005.
When was the compound last modified?
The compound was last modified on October 21, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is "3-prop-2-ynoxypropane-1,2-diol."
What is the InChI of the compound?
The InChI of the compound is "InChI=1S/C6H10O3/c1-2-3-9-5-6(8)4-7/h1,6-8H,3-5H2."
What is the InChIKey of the compound?
The InChIKey of the compound is "WZGADLPIFFITSG-UHFFFAOYSA-N."
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is "C#CCOCC(CO)O."
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.