After receiving 3'-hydroxybiphenyl-3-carbonitrile, the supporting instructions in the package are very detailed, including storage conditions and safety instructions.
What is the molecular formula of 3'-Hydroxybiphenyl-3-carbonitrile?
The molecular formula of 3'-Hydroxybiphenyl-3-carbonitrile is C13H9NO.
What is the molecular weight of 3'-Hydroxybiphenyl-3-carbonitrile?
The molecular weight of 3'-Hydroxybiphenyl-3-carbonitrile is 195.22 g/mol.
What is the IUPAC Name of 3'-Hydroxybiphenyl-3-carbonitrile?
The IUPAC Name of 3'-Hydroxybiphenyl-3-carbonitrile is 3-(3-hydroxyphenyl)benzonitrile.
What is the InChI of 3'-Hydroxybiphenyl-3-carbonitrile?
The InChI of 3'-Hydroxybiphenyl-3-carbonitrile is InChI=1S/C13H9NO/c14-9-10-3-1-4-11(7-10)12-5-2-6-13(15)8-12/h1-8,15H.
What is the InChIKey of 3'-Hydroxybiphenyl-3-carbonitrile?
The InChIKey of 3'-Hydroxybiphenyl-3-carbonitrile is IYDCWWPOHIRIQG-UHFFFAOYSA-N.
What is the Canonical SMILES of 3'-Hydroxybiphenyl-3-carbonitrile?
The Canonical SMILES of 3'-Hydroxybiphenyl-3-carbonitrile is C1=CC(=CC(=C1)C2=CC(=CC=C2)O)C#N.
What is the CAS number of 3'-Hydroxybiphenyl-3-carbonitrile?
The CAS number of 3'-Hydroxybiphenyl-3-carbonitrile is 154848-43-8.
What is the European Community (EC) number of 3'-Hydroxybiphenyl-3-carbonitrile?
The European Community (EC) number of 3'-Hydroxybiphenyl-3-carbonitrile is 633-859-0.
What is the molecular weight of 3'-Hydroxybiphenyl-3-carbonitrile according to PubChem?
The molecular weight of 3'-Hydroxybiphenyl-3-carbonitrile according to PubChem is 195.22 g/mol.
Is 3'-Hydroxybiphenyl-3-carbonitrile a canonicalized compound?
Yes, 3'-Hydroxybiphenyl-3-carbonitrile is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.