What is the molecular formula of (E)-2-Hexenyl butyrate?
The molecular formula of (E)-2-Hexenyl butyrate is C10H18O2.
What is the molecular weight of (E)-2-Hexenyl butyrate?
The molecular weight of (E)-2-Hexenyl butyrate is 170.25 g/mol.
What is the IUPAC name of (E)-2-Hexenyl butyrate?
The IUPAC name of (E)-2-Hexenyl butyrate is [(E)-hex-2-enyl] butanoate.
What is the InChI of (E)-2-Hexenyl butyrate?
The InChI of (E)-2-Hexenyl butyrate is InChI=1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h6-7H,3-5,8-9H2,1-2H3/b7-6+.
What is the InChIKey of (E)-2-Hexenyl butyrate?
The InChIKey of (E)-2-Hexenyl butyrate is PCGACKLJNBBQGM-VOTSOKGWSA-N.
What is the canonical SMILES of (E)-2-Hexenyl butyrate?
The canonical SMILES of (E)-2-Hexenyl butyrate is CCCC=CCOC(=O)CCC.
What is the CAS number of (E)-2-Hexenyl butyrate?
The CAS number of (E)-2-Hexenyl butyrate is 53398-83-7.
What is the FEMA number of (E)-2-Hexenyl butyrate?
The FEMA number of (E)-2-Hexenyl butyrate is 3926.
What is the molecular weight of (E)-2-Hexenyl butyrate according to PubChem?
The molecular weight of (E)-2-Hexenyl butyrate according to PubChem is 170.25 g/mol.
How many rotatable bond counts are there in (E)-2-Hexenyl butyrate?
There are 7 rotatable bond counts in (E)-2-Hexenyl butyrate.