What is the molecular formula of 2-methyl-4-heptanol?
The molecular formula of 2-methyl-4-heptanol is C8H18O.
What is the molecular weight of 2-methyl-4-heptanol?
The molecular weight of 2-methyl-4-heptanol is 130.23 g/mol.
Can you provide any synonyms for 2-methyl-4-heptanol?
Some synonyms for 2-methyl-4-heptanol are 2-Methylheptan-4-ol and 4-Heptanol, 2-methyl-.
What is the IUPAC name of 2-methyl-4-heptanol?
The IUPAC name of 2-methyl-4-heptanol is 2-methylheptan-4-ol.
What is the InChI of 2-methyl-4-heptanol?
The InChI of 2-methyl-4-heptanol is InChI=1S/C8H18O/c1-4-5-8(9)6-7(2)3/h7-9H,4-6H2,1-3H3.
What is the InChIKey of 2-methyl-4-heptanol?
The InChIKey of 2-methyl-4-heptanol is QXPLZEKPCGUWEM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-methyl-4-heptanol?
The canonical SMILES of 2-methyl-4-heptanol is CCCC(CC(C)C)O.
What is the CAS number of 2-methyl-4-heptanol?
The CAS number of 2-methyl-4-heptanol is 21570-35-4.
What is the European Community (EC) number of 2-methyl-4-heptanol?
The European Community (EC) number of 2-methyl-4-heptanol is 244-448-7.
What is the XLogP3-AA value of 2-methyl-4-heptanol?
The XLogP3-AA value of 2-methyl-4-heptanol is 2.5.