What is the molecular formula of 2-bromo-5-iodopyrazine?
The molecular formula of 2-bromo-5-iodopyrazine is C4H2BrIN2.
What is the molecular weight of 2-bromo-5-iodopyrazine?
The molecular weight of 2-bromo-5-iodopyrazine is 284.88 g/mol.
What are some synonyms for 2-bromo-5-iodopyrazine?
Some synonyms for 2-bromo-5-iodopyrazine include 2-Iodo-5-bromopyrazine and Pyrazine, 2-bromo-5-iodo-.
When was 2-bromo-5-iodopyrazine created?
2-bromo-5-iodopyrazine was created on December 5, 2007.
What is the InChI of 2-bromo-5-iodopyrazine?
The InChI of 2-bromo-5-iodopyrazine is InChI=1S/C4H2BrIN2/c5-3-1-8-4(6)2-7-3/h1-2H.
What is the Canonical SMILES of 2-bromo-5-iodopyrazine?
The Canonical SMILES of 2-bromo-5-iodopyrazine is C1=C(N=CC(=N1)I)Br.
What is the XLogP3-AA value of 2-bromo-5-iodopyrazine?
The XLogP3-AA value of 2-bromo-5-iodopyrazine is 1.5.
How many hydrogen bond acceptors does 2-bromo-5-iodopyrazine have?
2-bromo-5-iodopyrazine has 2 hydrogen bond acceptors.
What is the topological polar surface area of 2-bromo-5-iodopyrazine?
The topological polar surface area of 2-bromo-5-iodopyrazine is 25.8 Ų.
Is 2-bromo-5-iodopyrazine a canonicalized compound?
Yes, 2-bromo-5-iodopyrazine is a canonicalized compound.