What is the molecular formula of 2,6-Diisobutylaniline?
The molecular formula of 2,6-Diisobutylaniline is C14H23N.
What is the molecular weight of 2,6-Diisobutylaniline?
The molecular weight of 2,6-Diisobutylaniline is 205.34 g/mol.
What is the IUPAC name of 2,6-Diisobutylaniline?
The IUPAC name of 2,6-Diisobutylaniline is 2,6-bis(2-methylpropyl)aniline.
What is the InChI code of 2,6-Diisobutylaniline?
The InChI code of 2,6-Diisobutylaniline is InChI=1S/C14H23N/c1-10(2)8-12-6-5-7-13(14(12)15)9-11(3)4/h5-7,10-11H,8-9,15H2,1-4H3.
What is the InChIKey of 2,6-Diisobutylaniline?
The InChIKey of 2,6-Diisobutylaniline is PSIJIENWURFNAS-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2,6-Diisobutylaniline?
The Canonical SMILES representation of 2,6-Diisobutylaniline is CC(C)CC1=C(C(=CC=C1)CC(C)C)N.
What is the CAS number of 2,6-Diisobutylaniline?
The CAS number of 2,6-Diisobutylaniline is 957761-25-0.
What is the EC Number of 2,6-Diisobutylaniline?
The EC Number of 2,6-Diisobutylaniline is 694-046-4.
What is the XLogP3-AA value of 2,6-Diisobutylaniline?
The XLogP3-AA value of 2,6-Diisobutylaniline is 4.4.
Is 2,6-Diisobutylaniline a canonicalized compound?
Yes, 2,6-Diisobutylaniline is a canonicalized compound.