What is the PubChem CID for 2,4-Lupetidine hydrochloride?
The PubChem CID for 2,4-Lupetidine hydrochloride is 53487126.
What is the molecular formula of 2,4-Lupetidine hydrochloride?
The molecular formula of 2,4-Lupetidine hydrochloride is C7H16ClN.
What are the synonyms for 2,4-Lupetidine hydrochloride?
The synonyms for 2,4-Lupetidine hydrochloride include 2,4-Dimethylpiperidine hydrochloride, 2,4-Lupetidine HCl, and cis-2,4-Dimethylpiperidine hydrochloride.
What is the molecular weight of 2,4-Lupetidine hydrochloride?
The molecular weight of 2,4-Lupetidine hydrochloride is 149.66 g/mol.
What is the parent compound of 2,4-Lupetidine hydrochloride?
The parent compound of 2,4-Lupetidine hydrochloride is CID 95423 (2,4-Dimethylpiperidine).
What are the component compounds of 2,4-Lupetidine hydrochloride?
The component compounds of 2,4-Lupetidine hydrochloride are CID 95423 (2,4-Dimethylpiperidine) and CID 313 (Hydrochloric Acid).
What is the IUPAC name of 2,4-Lupetidine hydrochloride?
The IUPAC name of 2,4-Lupetidine hydrochloride is 2,4-dimethylpiperidine;hydrochloride.
What is the InChI of 2,4-Lupetidine hydrochloride?
The InChI of 2,4-Lupetidine hydrochloride is InChI=1S/C7H15N.ClH/c1-6-3-4-8-7(2)5-6;/h6-8H,3-5H2,1-2H3;1H.
What is the InChIKey of 2,4-Lupetidine hydrochloride?
The InChIKey of 2,4-Lupetidine hydrochloride is ZNWYEICTMCDWMH-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Lupetidine hydrochloride?
The canonical SMILES of 2,4-Lupetidine hydrochloride is CC1CCNC(C1)C.Cl.
※ Please kindly note that our products are for research use only.