What is the molecular formula of 2,3-dichloro-1-propanol?
The molecular formula of 2,3-dichloro-1-propanol is C3H6Cl2O.
What is the molecular weight of 2,3-dichloro-1-propanol?
The molecular weight of 2,3-dichloro-1-propanol is 128.98 g/mol.
What is the IUPAC name of 2,3-dichloro-1-propanol?
The IUPAC name of 2,3-dichloro-1-propanol is 2,3-dichloropropan-1-ol.
What is the InChI of 2,3-dichloro-1-propanol?
The InChI of 2,3-dichloro-1-propanol is InChI=1S/C3H6Cl2O/c4-1-3(5)2-6/h3,6H,1-2H2.
What is the InChIKey of 2,3-dichloro-1-propanol?
The InChIKey of 2,3-dichloro-1-propanol is ZXCYIJGIGSDJQQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-dichloro-1-propanol?
The canonical SMILES of 2,3-dichloro-1-propanol is C(C(CCl)Cl)O.
What is the CAS number of 2,3-dichloro-1-propanol?
The CAS number of 2,3-dichloro-1-propanol is 616-23-9.
What is the UNII of 2,3-dichloro-1-propanol?
The UNII of 2,3-dichloro-1-propanol is 88I7UKE7IM.
What is the ChEMBL ID of 2,3-dichloro-1-propanol?
The ChEMBL ID of 2,3-dichloro-1-propanol is CHEMBL1538584.