What is the molecular formula of 2,3,4,5,6-Pentabromobenzyl alcohol?
The molecular formula of 2,3,4,5,6-Pentabromobenzyl alcohol is C7H3Br5O.
What is the molecular weight of 2,3,4,5,6-Pentabromobenzyl alcohol?
The molecular weight of 2,3,4,5,6-Pentabromobenzyl alcohol is 502.62 g/mol.
What is the IUPAC name of 2,3,4,5,6-Pentabromobenzyl alcohol?
The IUPAC name of 2,3,4,5,6-Pentabromobenzyl alcohol is (2,3,4,5,6-pentabromophenyl)methanol.
What is the InChI of 2,3,4,5,6-Pentabromobenzyl alcohol?
The InChI of 2,3,4,5,6-Pentabromobenzyl alcohol is InChI=1S/C7H3Br5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h13H,1H2.
What is the InChIKey of 2,3,4,5,6-Pentabromobenzyl alcohol?
The InChIKey of 2,3,4,5,6-Pentabromobenzyl alcohol is KKWHDMUCBWSKGL-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,4,5,6-Pentabromobenzyl alcohol?
The canonical SMILES of 2,3,4,5,6-Pentabromobenzyl alcohol is C(C1=C(C(=C(C(=C1Br)Br)Br)Br)Br)O.
What is the CAS number of 2,3,4,5,6-Pentabromobenzyl alcohol?
The CAS number of 2,3,4,5,6-Pentabromobenzyl alcohol is 79415-41-1.
What is the EC number of 2,3,4,5,6-Pentabromobenzyl alcohol?
The EC number of 2,3,4,5,6-Pentabromobenzyl alcohol is 623-305-6.
What is the hydrogen bond donor count of 2,3,4,5,6-Pentabromobenzyl alcohol?
The hydrogen bond donor count of 2,3,4,5,6-Pentabromobenzyl alcohol is 1.
What is the hydrogen bond acceptor count of 2,3,4,5,6-Pentabromobenzyl alcohol?
The hydrogen bond acceptor count of 2,3,4,5,6-Pentabromobenzyl alcohol is 1.