What is the molecular formula of 1-Octen-3-ol?
The molecular formula of 1-Octen-3-ol is C8H16O.
What is the molecular weight of 1-Octen-3-ol?
The molecular weight of 1-Octen-3-ol is 128.21 g/mol.
What is the IUPAC name of 1-Octen-3-ol?
The IUPAC name of 1-Octen-3-ol is oct-1-en-3-ol.
What is the InChI of 1-Octen-3-ol?
The InChI of 1-Octen-3-ol is InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3.
What is the InChIKey of 1-Octen-3-ol?
The InChIKey of 1-Octen-3-ol is VSMOENVRRABVKN-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Octen-3-ol?
The canonical SMILES of 1-Octen-3-ol is CCCCCC(C=C)O.
What is the CAS number of 1-Octen-3-ol?
The CAS number of 1-Octen-3-ol is 3391-86-4.
What is the FEMA number of 1-Octen-3-ol?
The FEMA number of 1-Octen-3-ol is 2805.
What is the JECFA number of 1-Octen-3-ol?
The JECFA number of 1-Octen-3-ol is 1152.
What is the Wikipedia page for 1-Octen-3-ol?
The Wikipedia page for 1-Octen-3-ol is "1-Octen-3-ol".