What is the molecular formula of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The molecular formula is C23H24BrO2P.
What is the molecular weight of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The molecular weight is 443.3 g/mol.
What are the synonyms for [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The synonyms are 30018-16-7, (1-Ethoxy-1-oxopropan-2-yl)triphenylphosphonium bromide, 1-(Ethoxycarbonyl)ethyltriphenylphosphonium bromide, and 1-CARBETHOXYETHYL TRIPHENYLPHOSPHONIUM BROMIDE.
What is the IUPAC name of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The IUPAC name is (1-ethoxy-1-oxopropan-2-yl)-triphenylphosphanium; bromide.
What is the InChI of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The InChI is InChI=1S/C23H24O2P.BrH/c1-3-25-23(24)19(2)26(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-19H,3H2,1-2H3;1H/q+1;/p-1.
What is the InChIKey of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The InChIKey is RSYXORMKBUFAMS-UHFFFAOYSA-M.
What is the canonical SMILES of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The canonical SMILES is CCOC(=O)C(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-].
What is the CAS number of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The CAS number is 30018-16-7.
What is the European Community (EC) number of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The European Community (EC) number is 250-002-2.
What is the molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, and rotatable bond count of [1-(Ethoxycarbonyl)ethyl]triphenylphosphonium bromide?
The molecular weight is 443.3 g/mol, the hydrogen bond donor count is 0, the hydrogen bond acceptor count is 3, and the rotatable bond count is 7.
※ Please kindly note that our products are for research use only.