What is the molecular formula of 1,4-Diisopropylbenzene?
The molecular formula of 1,4-Diisopropylbenzene is C12H18.
What is the molecular weight of 1,4-Diisopropylbenzene?
The molecular weight of 1,4-Diisopropylbenzene is 162.27 g/mol.
What is the IUPAC name of 1,4-Diisopropylbenzene?
The IUPAC name of 1,4-Diisopropylbenzene is 1,4-di(propan-2-yl)benzene.
What is the InChI of 1,4-Diisopropylbenzene?
The InChI of 1,4-Diisopropylbenzene is InChI=1S/C12H18/c1-9(2)11-5-7-12(8-6-11)10(3)4/h5-10H,1-4H3.
What is the InChIKey of 1,4-Diisopropylbenzene?
The InChIKey of 1,4-Diisopropylbenzene is SPPWGCYEYAMHDT-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Diisopropylbenzene?
The canonical SMILES of 1,4-Diisopropylbenzene is CC(C)C1=CC=C(C=C1)C(C)C.
What is the CAS number of 1,4-Diisopropylbenzene?
The CAS number of 1,4-Diisopropylbenzene is 100-18-5.
What is the European Community (EC) number of 1,4-Diisopropylbenzene?
The European Community (EC) number of 1,4-Diisopropylbenzene is 202-826-9.
What is the ChEMBL ID of 1,4-Diisopropylbenzene?
The ChEMBL ID of 1,4-Diisopropylbenzene is CHEMBL1872836.