What is the molecular formula of 1,3,5-Triethylbenzene?
The molecular formula of 1,3,5-Triethylbenzene is C12H18.
What is the molecular weight of 1,3,5-Triethylbenzene?
The molecular weight of 1,3,5-Triethylbenzene is 162.27 g/mol.
When was 1,3,5-Triethylbenzene created?
1,3,5-Triethylbenzene was created on March 26, 2005.
What is the InChI of 1,3,5-Triethylbenzene?
The InChI of 1,3,5-Triethylbenzene is InChI=1S/C12H18/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7-9H,4-6H2,1-3H3.
What is the InChIKey of 1,3,5-Triethylbenzene?
The InChIKey of 1,3,5-Triethylbenzene is WJYMPXJVHNDZHD-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,3,5-Triethylbenzene?
The Canonical SMILES of 1,3,5-Triethylbenzene is CCC1=CC(=CC(=C1)CC)CC.
What is the CAS number of 1,3,5-Triethylbenzene?
The CAS number of 1,3,5-Triethylbenzene is 102-25-0.
What is the XLogP3-AA value of 1,3,5-Triethylbenzene?
The XLogP3-AA value of 1,3,5-Triethylbenzene is 4.3.
Is 1,3,5-Triethylbenzene a canonicalized compound?
Yes, 1,3,5-Triethylbenzene is canonicalized.