What is the PubChem CID of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The PubChem CID is 79909.
What is the molecular formula of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The molecular formula is C6H14OSi.
What are the synonyms of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The synonyms include 5833-47-6, 1,1-DIMETHYL-1-SILA-2-OXACYCLOHEXANE, 1-Oxa-2-silacyclohexane, 2,2-dimethyl- 2,2-dimethyloxasilinane, 2,2-dimethyl-1,2-oxasilinane.
What is the molecular weight of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The molecular weight is 130.26 g/mol.
When was 1,1-Dimethyl-1-sila-2-oxacyclohexane created and modified in PubChem?
It was created on August 8, 2005, and modified on November 25, 2023.
What is the IUPAC name of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The IUPAC name is 2,2-dimethyloxasilinane.
What is the InChI of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The InChI is InChI=1S/C6H14OSi/c1-8(2)6-4-3-5-7-8/h3-6H2,1-2H3.
What is the InChIKey of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The InChIKey is CWUHERHJSPPFHQ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The canonical SMILES is C[Si]1(CCCCO1)C.
What is the CAS number of 1,1-Dimethyl-1-sila-2-oxacyclohexane?
The CAS number is 5833-47-6.
※ Please kindly note that our products are for research use only.