What is the molecular formula of Potassium (3-chlorophenyl)trifluoroborate?
The molecular formula of Potassium (3-chlorophenyl)trifluoroborate is C6H4BClF3K.
What are the synonyms for Potassium (3-chlorophenyl)trifluoroborate?
The synonyms for Potassium (3-chlorophenyl)trifluoroborate are 411206-75-2, Potassium 3-chlorophenyltrifluoroborate, potassium;(3-chlorophenyl)-trifluoroboranuide, and MFCD04115754.
What is the molecular weight of Potassium (3-chlorophenyl)trifluoroborate?
The molecular weight of Potassium (3-chlorophenyl)trifluoroborate is 218.45 g/mol.
What is the parent compound of Potassium (3-chlorophenyl)trifluoroborate?
The parent compound of Potassium (3-chlorophenyl)trifluoroborate is CID 2782861 ((3-Chlorophenyl)-trifluoroboranuide).
What are the component compounds of Potassium (3-chlorophenyl)trifluoroborate?
The component compounds of Potassium (3-chlorophenyl)trifluoroborate are CID 2782861 ((3-Chlorophenyl)-trifluoroboranuide) and CID 5462222 (Potassium).
What is the IUPAC name of Potassium (3-chlorophenyl)trifluoroborate?
The IUPAC name of Potassium (3-chlorophenyl)trifluoroborate is potassium;(3-chlorophenyl)-trifluoroboranuide.
What is the InChI of Potassium (3-chlorophenyl)trifluoroborate?
The InChI of Potassium (3-chlorophenyl)trifluoroborate is InChI=1S/C6H4BClF3.K/c8-6-3-1-2-5(4-6)7(9,10)11;/h1-4H;/q-1;+1.
What is the InChIKey of Potassium (3-chlorophenyl)trifluoroborate?
The InChIKey of Potassium (3-chlorophenyl)trifluoroborate is LRJCVRYGKNDLAD-UHFFFAOYSA-N.
What is the canonical SMILES of Potassium (3-chlorophenyl)trifluoroborate?
The canonical SMILES of Potassium (3-chlorophenyl)trifluoroborate is [B-](C1=CC(=CC=C1)Cl)(F)(F)F.[K+].
What is the CAS number of Potassium (3-chlorophenyl)trifluoroborate?
The CAS number of Potassium (3-chlorophenyl)trifluoroborate is 411206-75-2.
※ Please kindly note that our products are for research use only.