What is the molecular formula of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The molecular formula of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is C17H36O8.
What are the synonyms for Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The synonyms for Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) are 25214-14-6 and SCHEMBL2487662.
What is the molecular weight of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The molecular weight of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is 368.5 g/mol.
What are the component compounds of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The component compounds of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) are Adipic Acid (CID 196), Hexane-1,6-diol (CID 12374), and Neopentyl glycol (CID 31344).
When was Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) created and last modified?
Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) was created on 2005-08-08 and last modified on 2023-12-02.
What is the IUPAC name of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The IUPAC name of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is 2,2-dimethylpropane-1,3-diol;hexanedioic acid;hexane-1,6-diol.
What is the InChI of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The InChI of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is InChI=1S/C6H10O4.C6H14O2.C5H12O2/c7-5(8)3-1-2-4-6(9)10;7-5-3-1-2-4-6-8;1-5(2,3-6)4-7/h1-4H2,(H,7,8)(H,9,10);7-8H,1-6H2;6-7H,3-4H2,1-2H3.
What is the InChIKey of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The InChIKey of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is HNIBILYKBWAIPI-UHFFFAOYSA-N.
What is the canonical SMILES of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The canonical SMILES of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is CC(C)(CO)CO.C(CCCO)CCO.C(CCC(=O)O)CC(=O)O.
What is the CAS number of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid)?
The CAS number of Poly(1,6-hexanediol/neopentyl glycol-alt-adipic acid) is 25214-14-6.