What is the molecular formula of Picloxydine?
The molecular formula of Picloxydine is C20H24Cl2N10.
What is the molecular weight of Picloxydine?
The molecular weight of Picloxydine is 475.4 g/mol.
What is the IUPAC name of Picloxydine?
The IUPAC name of Picloxydine is 1-N',4-N'-bis[N'-(4-chlorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide.
What is the InChI of Picloxydine?
The InChI of Picloxydine is InChI=1S/C20H24Cl2N10/c21-13-1-5-15(6-2-13)27-17(23)29-19(25)31-9-11-32(12-10-31)20(26)30-18(24)28-16-7-3-14(22)4-8-16/h1-8H,9-12H2,(H4,23,25,27,29)(H4,24,26,28,30).
What is the InChIKey of Picloxydine?
The InChIKey of Picloxydine is YNCLPFSAZFGQCD-UHFFFAOYSA-N.
What are the synonyms of Picloxydine?
The synonyms of Picloxydine are Picloxidina, 5636-92-0, 4YC2PY3AEU, and Picloxydine (INN).
What is the CAS number of Picloxydine?
The CAS number of Picloxydine is 5636-92-0.
What is the molecular weight of Picloxydine calculated by PubChem?
The molecular weight of Picloxydine is 475.4 g/mol, computed by PubChem.
What is the XLogP3-AA value of Picloxydine?
The XLogP3-AA value of Picloxydine is 1.8.
What is the hydrogen bond donor count of Picloxydine?
The hydrogen bond donor count of Picloxydine is 4.