What is the molecular formula of Phenyltrichlorogermane?
The molecular formula of Phenyltrichlorogermane is C6H5Cl3Ge.
What is the molecular weight of Phenyltrichlorogermane?
The molecular weight of Phenyltrichlorogermane is 256.1 g/mol.
What is the IUPAC name of Phenyltrichlorogermane?
The IUPAC name of Phenyltrichlorogermane is trichloro(phenyl)germane.
What is the InChI of Phenyltrichlorogermane?
The InChI of Phenyltrichlorogermane is InChI=1S/C6H5Cl3Ge/c7-10(8,9)6-4-2-1-3-5-6/h1-5H.
What is the InChIKey of Phenyltrichlorogermane?
The InChIKey of Phenyltrichlorogermane is CIWQSBMDFPABPQ-UHFFFAOYSA-N.
What is the canonical SMILES of Phenyltrichlorogermane?
The canonical SMILES of Phenyltrichlorogermane is C1=CC=C(C=C1)[Ge](Cl)(Cl)Cl.
What is the CAS number of Phenyltrichlorogermane?
The CAS number of Phenyltrichlorogermane is 1074-29-9.
What is the EC number of Phenyltrichlorogermane?
The EC number of Phenyltrichlorogermane is 214-039-8.
How many heavy atoms are there in Phenyltrichlorogermane?
There are 10 heavy atoms in Phenyltrichlorogermane.
Is Phenyltrichlorogermane a canonicalized compound?
Yes, Phenyltrichlorogermane is a canonicalized compound.